C18H29NOS2 — CID 95164397
1-[(1R,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one (PubChem CID 95164397) has the molecular formula C18H29NOS2 and a molecular weight of 339.57 g/mol. Its IUPAC name is 1-[(1R,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one.
| Compound Name | 1-[(1R,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 95164397 |
| Molecular Formula | C18H29NOS2 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[(1R,8S)-4-azatricyclo[4.3.1.13,8]undecan-4-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one |
| SMILES | O=C(CCCC[C@H]1CCSS1)N1CC2C[C@@H]3CC1C[C@H](C2)C3 |
| InChI | InChI=1S/C18H29NOS2/c20-18(4-2-1-3-17-5-6-21-22-17)19-12-15-8-13-7-14(9-15)11-16(19)10-13/h13-17H,1-12H2/t13-,14+,15?,16?,17-/m0/s1 |
| InChIKey | MTQLBSNIPJWOSQ-RRLIJXGGSA-N |
| XLogP | 4.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|