C16H32N4OS2 — CID 76901582
5-[(3S)-dithiolan-3-yl]-1-(1,4,7,10-tetrazacyclododec-1-yl)pentan-1-one (PubChem CID 76901582) has the molecular formula C16H32N4OS2 and a molecular weight of 360.59 g/mol. Its IUPAC name is 5-[(3S)-dithiolan-3-yl]-1-(1,4,7,10-tetrazacyclododec-1-yl)pentan-1-one.
| Compound Name | 5-[(3S)-dithiolan-3-yl]-1-(1,4,7,10-tetrazacyclododec-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 76901582 |
| Molecular Formula | C16H32N4OS2 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 5-[(3S)-dithiolan-3-yl]-1-(1,4,7,10-tetrazacyclododec-1-yl)pentan-1-one |
| SMILES | O=C(CCCC[C@H]1CCSS1)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C16H32N4OS2/c21-16(4-2-1-3-15-5-14-22-23-15)20-12-10-18-8-6-17-7-9-19-11-13-20/h15,17-19H,1-14H2/t15-/m0/s1 |
| InChIKey | NVDFVSRNBLUWLV-HNNXBMFYSA-N |
| XLogP | 1.31 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|