C15H25F3N2OS2 — CID 78870078
5-(dithiolan-3-yl)-1-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-one (PubChem CID 78870078) has the molecular formula C15H25F3N2OS2 and a molecular weight of 370.51 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-one.
| Compound Name | 5-(dithiolan-3-yl)-1-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 78870078 |
| Molecular Formula | C15H25F3N2OS2 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H25F3N2OS2/c16-15(17,18)12-19-7-3-8-20(10-9-19)14(21)5-2-1-4-13-6-11-22-23-13/h13H,1-12H2 |
| InChIKey | KBACEMXAEVBWEJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|