C17H33N3OS2 — CID 157423198
5-(dithiolan-3-yl)-1-(1,4,7-triazacyclododec-1-yl)pentan-1-one (PubChem CID 157423198) has the molecular formula C17H33N3OS2 and a molecular weight of 359.61 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-(1,4,7-triazacyclododec-1-yl)pentan-1-one.
| Compound Name | 5-(dithiolan-3-yl)-1-(1,4,7-triazacyclododec-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 157423198 |
| Molecular Formula | C17H33N3OS2 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-(1,4,7-triazacyclododec-1-yl)pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCCCCNCCNCC1 |
| InChI | InChI=1S/C17H33N3OS2/c21-17(7-3-2-6-16-8-15-22-23-16)20-13-5-1-4-9-18-10-11-19-12-14-20/h16,18-19H,1-15H2 |
| InChIKey | JFOKBGDWYPFVKB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|