C20H33N3OS3 — CID 78902979
1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one (PubChem CID 78902979) has the molecular formula C20H33N3OS3 and a molecular weight of 427.71 g/mol. Its IUPAC name is 1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one.
| Compound Name | 1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 78902979 |
| Molecular Formula | C20H33N3OS3 |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-(dithiolan-3-yl)pentan-1-one |
| SMILES | CC(C)(C)c1nc(CN2CCN(C(=O)CCCCC3CCSS3)CC2)cs1 |
| InChI | InChI=1S/C20H33N3OS3/c1-20(2,3)19-21-16(15-25-19)14-22-9-11-23(12-10-22)18(24)7-5-4-6-17-8-13-26-27-17/h15,17H,4-14H2,1-3H3 |
| InChIKey | QOXYUMSOGYJSOX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|