C21H32N2O3S3 — CID 24640317
5-(dithiolan-3-yl)-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 24640317) has the molecular formula C21H32N2O3S3 and a molecular weight of 456.70 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-(dithiolan-3-yl)-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 24640317 |
| Molecular Formula | C21H32N2O3S3 |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(C(=O)CCCCC3CCSS3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H32N2O3S3/c1-16-14-17(2)21(18(3)15-16)29(25,26)23-11-9-22(10-12-23)20(24)7-5-4-6-19-8-13-27-28-19/h14-15,19H,4-13H2,1-3H3 |
| InChIKey | FNKAKGSATZFGFK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|