C20H30N2O4S3 — CID 55406751
5-(dithiolan-3-yl)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 55406751) has the molecular formula C20H30N2O4S3 and a molecular weight of 458.67 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-(dithiolan-3-yl)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 55406751 |
| Molecular Formula | C20H30N2O4S3 |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)CCCCC3CCSS3)CC2)cc1 |
| InChI | InChI=1S/C20H30N2O4S3/c1-2-26-17-7-9-19(10-8-17)29(24,25)22-14-12-21(13-15-22)20(23)6-4-3-5-18-11-16-27-28-18/h7-10,18H,2-6,11-16H2,1H3 |
| InChIKey | XDMMAZGSTWEVQM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|