C16H29NOS2 — CID 99811073
1-[(2R,6R)-2,6-dimethylazepan-1-yl]-5-[(3R)-dithiolan-3-yl]pentan-1-one (PubChem CID 99811073) has the molecular formula C16H29NOS2 and a molecular weight of 315.55 g/mol. Its IUPAC name is 1-[(2R,6R)-2,6-dimethylazepan-1-yl]-5-[(3R)-dithiolan-3-yl]pentan-1-one.
| Compound Name | 1-[(2R,6R)-2,6-dimethylazepan-1-yl]-5-[(3R)-dithiolan-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 99811073 |
| Molecular Formula | C16H29NOS2 |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[(2R,6R)-2,6-dimethylazepan-1-yl]-5-[(3R)-dithiolan-3-yl]pentan-1-one |
| SMILES | C[C@@H]1CCC[C@@H](C)N(C(=O)CCCC[C@@H]2CCSS2)C1 |
| InChI | InChI=1S/C16H29NOS2/c1-13-6-5-7-14(2)17(12-13)16(18)9-4-3-8-15-10-11-19-20-15/h13-15H,3-12H2,1-2H3/t13-,14-,15-/m1/s1 |
| InChIKey | DMVOZYQMPNJXCS-RBSFLKMASA-N |
| XLogP | 4.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|