C18H19FIN3O2 — CID 170125003
3-[4-(4-fluorophenyl)-6-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]-5-oxopyrazin-2-yl]propyl hypoiodite (PubChem CID 170125003) has the molecular formula C18H19FIN3O2 and a molecular weight of 455.27 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-6-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]-5-oxopyrazin-2-yl]propyl hypoiodite.
| Compound Name | 3-[4-(4-fluorophenyl)-6-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]-5-oxopyrazin-2-yl]propyl hypoiodite |
|---|---|
| PubChem CID | 170125003 |
| Molecular Formula | C18H19FIN3O2 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-6-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]-5-oxopyrazin-2-yl]propyl hypoiodite |
| SMILES | C=C/C(=C\NC)c1nc(CCCOI)cn(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C18H19FIN3O2/c1-3-13(11-21-2)17-18(24)23(16-8-6-14(19)7-9-16)12-15(22-17)5-4-10-25-20/h3,6-9,11-12,21H,1,4-5,10H2,2H3/b13-11+ |
| InChIKey | WODXJWBXVIVXCV-ACCUITESSA-N |
| XLogP | 3.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|