About N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide
N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide (PubChem CID 170129600) has the molecular formula C17H21BrN2OS
and a molecular weight of 381.34 g/mol. Its IUPAC name is N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide.
Molecular Properties
| Compound Name | N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide |
| PubChem CID | 170129600 |
| Molecular Formula | C17H21BrN2OS |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide |
| SMILES | Cc1sc(C)c(CCN(CCNC=O)c2ccccc2)c1Br |
| InChI | InChI=1S/C17H21BrN2OS/c1-13-16(17(18)14(2)22-13)8-10-20(11-9-19-12-21)15-6-4-3-5-7-15/h3-7,12H,8-11H2,1-2H3,(H,19,21) |
| InChIKey | NKIRLGNTAXXLGL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide?
The IUPAC name of N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide (CID 170129600) is N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide.
What is the SMILES notation for N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide?
The canonical SMILES for N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide is Cc1sc(C)c(CCN(CCNC=O)c2ccccc2)c1Br.
What is the InChIKey of N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide?
The InChIKey is NKIRLGNTAXXLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrN2OS/c1-13-16(17(18)14(2)22-13)8-10-20(11-9-19-12-21)15-6-4-3-5-7-15/h3-7,12H,8-11H2,1-2H3,(H,19,21).
What are the key properties of N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide?
N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide has a molecular weight of 381.34 g/mol, XLogP of 3.92, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[N-[2-(4-bromo-2,5-dimethylthiophen-3-yl)ethyl]anilino]ethyl]formamide is sourced from PubChem (CID 170129600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).