C47H37N3O — CID 170131534
2-(6-dibenzofuran-1-yl-1,2-dihydronaphthalen-2-yl)-4-[4-[(1Z,3E,5Z,7Z)-4-methylnona-1,3,5,7-tetraenyl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 170131534) has the molecular formula C47H37N3O and a molecular weight of 659.83 g/mol. Its IUPAC name is 2-(6-dibenzofuran-1-yl-1,2-dihydronaphthalen-2-yl)-4-[4-[(1Z,3E,5Z,7Z)-4-methylnona-1,3,5,7-tetraenyl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(6-dibenzofuran-1-yl-1,2-dihydronaphthalen-2-yl)-4-[4-[(1Z,3E,5Z,7Z)-4-methylnona-1,3,5,7-tetraenyl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170131534 |
| Molecular Formula | C47H37N3O |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | 2-(6-dibenzofuran-1-yl-1,2-dihydronaphthalen-2-yl)-4-[4-[(1Z,3E,5Z,7Z)-4-methylnona-1,3,5,7-tetraenyl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C\C=C/C(C)=C/C=C\c1ccc(-c2nc(-c3ccccc3)nc(C3C=Cc4cc(-c5cccc6oc7ccccc7c56)ccc4C3)n2)cc1 |
| InChI | InChI=1S/C47H37N3O/c1-3-4-6-13-32(2)14-11-15-33-22-24-35(25-23-33)46-48-45(34-16-7-5-8-17-34)49-47(50-46)39-29-27-36-30-38(28-26-37(36)31-39)40-19-12-21-43-44(40)41-18-9-10-20-42(41)51-43/h3-30,39H,31H2,1-2H3/b4-3-,13-6-,15-11-,32-14+ |
| InChIKey | SQCCZMSPQMDRIA-HXWQZEDXSA-N |
| XLogP | 12.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|