C27H25F2N6OP — CID 170131711
1-ethyl-N-(1-ethylpyrazol-4-yl)-5-fluoro-2-[(2-fluorophenyl)-(2-phosphanylphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 170131711) has the molecular formula C27H25F2N6OP and a molecular weight of 518.51 g/mol. Its IUPAC name is 1-ethyl-N-(1-ethylpyrazol-4-yl)-5-fluoro-2-[(2-fluorophenyl)-(2-phosphanylphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 1-ethyl-N-(1-ethylpyrazol-4-yl)-5-fluoro-2-[(2-fluorophenyl)-(2-phosphanylphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 170131711 |
| Molecular Formula | C27H25F2N6OP |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 1-ethyl-N-(1-ethylpyrazol-4-yl)-5-fluoro-2-[(2-fluorophenyl)-(2-phosphanylphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cc3c(nc2F)nc(C(c2ccccc2F)c2ccccc2P)n3CC)cn1 |
| InChI | InChI=1S/C27H25F2N6OP/c1-3-34-15-16(14-30-34)31-27(36)19-13-21-25(32-24(19)29)33-26(35(21)4-2)23(17-9-5-7-11-20(17)28)18-10-6-8-12-22(18)37/h5-15,23H,3-4,37H2,1-2H3,(H,31,36) |
| InChIKey | ONAKWPOZEXIIDJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|