C27H25ClN6O2 — CID 168678854
5-chloro-1-ethyl-N-(1-ethylpyrazol-4-yl)-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 168678854) has the molecular formula C27H25ClN6O2 and a molecular weight of 500.99 g/mol. Its IUPAC name is 5-chloro-1-ethyl-N-(1-ethylpyrazol-4-yl)-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 5-chloro-1-ethyl-N-(1-ethylpyrazol-4-yl)-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 168678854 |
| Molecular Formula | C27H25ClN6O2 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 5-chloro-1-ethyl-N-(1-ethylpyrazol-4-yl)-2-[hydroxy(diphenyl)methyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cc3c(nc2Cl)nc(C(O)(c2ccccc2)c2ccccc2)n3CC)cn1 |
| InChI | InChI=1S/C27H25ClN6O2/c1-3-33-17-20(16-29-33)30-25(35)21-15-22-24(31-23(21)28)32-26(34(22)4-2)27(36,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-17,36H,3-4H2,1-2H3,(H,30,35) |
| InChIKey | CKUZGWURDBJSNP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|