C40H28N4S — CID 170133420
2-[(1Z)-buta-1,3-dienyl]-8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-phenyl-[1]benzothiolo[3,2-f]indole (PubChem CID 170133420) has the molecular formula C40H28N4S and a molecular weight of 596.76 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-phenyl-[1]benzothiolo[3,2-f]indole.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-phenyl-[1]benzothiolo[3,2-f]indole |
|---|---|
| PubChem CID | 170133420 |
| Molecular Formula | C40H28N4S |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-methyl-1-phenyl-[1]benzothiolo[3,2-f]indole |
| SMILES | C=C/C=C\c1c(C)c2cc3c(cc2n1-c1ccccc1)sc1c(-c2nc(-c4ccccc4)nc(-c4ccccc4)n2)cccc13 |
| InChI | InChI=1S/C40H28N4S/c1-3-4-23-34-26(2)32-24-33-30-21-14-22-31(37(30)45-36(33)25-35(32)44(34)29-19-12-7-13-20-29)40-42-38(27-15-8-5-9-16-27)41-39(43-40)28-17-10-6-11-18-28/h3-25H,1H2,2H3/b23-4- |
| InChIKey | CAXNEAQQYBYOCZ-WVHIBCRRSA-N |
| XLogP | 10.69 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|