C66H38N8O2 — CID 170133824
3-[3-[4,6-bis[4-(3-cyanophenyl)-2-phenoxazin-10-ylphenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 170133824) has the molecular formula C66H38N8O2 and a molecular weight of 975.08 g/mol. Its IUPAC name is 3-[3-[4,6-bis[4-(3-cyanophenyl)-2-phenoxazin-10-ylphenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 3-[3-[4,6-bis[4-(3-cyanophenyl)-2-phenoxazin-10-ylphenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170133824 |
| Molecular Formula | C66H38N8O2 |
| Molecular Weight | 975.08 g/mol |
| Exact Mass | 974.31 |
| IUPAC Name | 3-[3-[4,6-bis[4-(3-cyanophenyl)-2-phenoxazin-10-ylphenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccc(-c3nc(-c4ccc(-c5cccc(C#N)c5)cc4N4c5ccccc5Oc5ccccc54)nc(-c4ccc(-c5cccc(C#N)c5)cc4N4c5ccccc5Oc5ccccc54)n3)c2)c1 |
| InChI | InChI=1S/C66H38N8O2/c67-39-42-13-9-16-45(33-42)48-19-12-20-51(36-48)64-70-65(52-31-29-49(46-17-10-14-43(34-46)40-68)37-58(52)73-54-21-1-5-25-60(54)75-61-26-6-2-22-55(61)73)72-66(71-64)53-32-30-50(47-18-11-15-44(35-47)41-69)38-59(53)74-56-23-3-7-27-62(56)76-63-28-8-4-24-57(63)74/h1-38H |
| InChIKey | NTLGKIRGJLMKMV-UHFFFAOYSA-N |
| XLogP | 16.64 |
| TPSA | 134.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.08 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |