C54H36N8 — CID 170136413
7-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-8,9-dihydroindolo[2,3-b]carbazole (PubChem CID 170136413) has the molecular formula C54H36N8 and a molecular weight of 796.94 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-8,9-dihydroindolo[2,3-b]carbazole.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-8,9-dihydroindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 170136413 |
| Molecular Formula | C54H36N8 |
| Molecular Weight | 796.94 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-8,9-dihydroindolo[2,3-b]carbazole |
| SMILES | C1=Cc2c(n(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3cc4c(cc23)c2ccccc2n4-c2ccccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C54H36N8/c1-5-19-35(20-6-1)49-55-50(36-21-7-2-8-22-36)58-53(57-49)41-29-15-18-32-46(41)61-44-30-16-13-27-39(44)42-33-43-40-28-14-17-31-45(40)62(48(43)34-47(42)61)54-59-51(37-23-9-3-10-24-37)56-52(60-54)38-25-11-4-12-26-38/h1-16,18-30,32-34H,17,31H2 |
| InChIKey | NZIVXTWVOGZCBJ-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.94 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |