C23H44N4 — CID 170139657
4-[2-(1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl)-2-methylpropyl]-8-tert-butyl-2,8-diazaspiro[4.5]decane (PubChem CID 170139657) has the molecular formula C23H44N4 and a molecular weight of 376.63 g/mol. Its IUPAC name is 4-[2-(1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl)-2-methylpropyl]-8-tert-butyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 4-[2-(1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl)-2-methylpropyl]-8-tert-butyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 170139657 |
| Molecular Formula | C23H44N4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.36 |
| IUPAC Name | 4-[2-(1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl)-2-methylpropyl]-8-tert-butyl-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)N1CCC2(CC1)CNCC2CC(C)(C)N1CCC2CCNC2C1 |
| InChI | InChI=1S/C23H44N4/c1-21(2,3)26-12-8-23(9-13-26)17-24-15-19(23)14-22(4,5)27-11-7-18-6-10-25-20(18)16-27/h18-20,24-25H,6-17H2,1-5H3 |
| InChIKey | BIQXGFGCBHKOMU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |