C12H14BrF3O6 — CID 170139987
propyl 2-bromo-5-(4,4-difluoro-3-oxobutanoyl)oxy-4-fluoro-3-oxopentanoate (PubChem CID 170139987) has the molecular formula C12H14BrF3O6 and a molecular weight of 391.14 g/mol. Its IUPAC name is propyl 2-bromo-5-(4,4-difluoro-3-oxobutanoyl)oxy-4-fluoro-3-oxopentanoate.
| Compound Name | propyl 2-bromo-5-(4,4-difluoro-3-oxobutanoyl)oxy-4-fluoro-3-oxopentanoate |
|---|---|
| PubChem CID | 170139987 |
| Molecular Formula | C12H14BrF3O6 |
| Molecular Weight | 391.14 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | propyl 2-bromo-5-(4,4-difluoro-3-oxobutanoyl)oxy-4-fluoro-3-oxopentanoate |
| SMILES | CCCOC(=O)C(Br)C(=O)C(F)COC(=O)CC(=O)C(F)F |
| InChI | InChI=1S/C12H14BrF3O6/c1-2-3-21-12(20)9(13)10(19)6(14)5-22-8(18)4-7(17)11(15)16/h6,9,11H,2-5H2,1H3 |
| InChIKey | GVVNBOYIWPNIGE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|