About 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate
1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate (PubChem CID 91002470) has the molecular formula C18H32O14S2
and a molecular weight of 536.57 g/mol. Its IUPAC name is 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate |
| PubChem CID | 91002470 |
| Molecular Formula | C18H32O14S2 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate |
| SMILES | CCCOC(=O)C(CC(=O)OC)S(=O)(=O)OC.CCCOC(=O)CC(C(=O)OC)S(=O)(=O)OC |
| InChI | InChI=1S/2C9H16O7S/c1-4-5-16-8(10)6-7(9(11)14-2)17(12,13)15-3;1-4-5-16-9(11)7(6-8(10)14-2)17(12,13)15-3/h2*7H,4-6H2,1-3H3 |
| InChIKey | KEGXGLNHRUVGPE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate?
The IUPAC name of 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate (CID 91002470) is 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate.
What is the SMILES notation for 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate?
The canonical SMILES for 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate is CCCOC(=O)C(CC(=O)OC)S(=O)(=O)OC.CCCOC(=O)CC(C(=O)OC)S(=O)(=O)OC.
What is the InChIKey of 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate?
The InChIKey is KEGXGLNHRUVGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H16O7S/c1-4-5-16-8(10)6-7(9(11)14-2)17(12,13)15-3;1-4-5-16-9(11)7(6-8(10)14-2)17(12,13)15-3/h2*7H,4-6H2,1-3H3.
What are the key properties of 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate?
1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate has a molecular weight of 536.57 g/mol, XLogP of -0.31, 14 rotatable bonds, 0 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 4-O-propyl 2-methoxysulfonylbutanedioate;4-O-methyl 1-O-propyl 2-methoxysulfonylbutanedioate is sourced from PubChem (CID 91002470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).