C6H9O7S- — CID 20670459
1,4-dimethoxy-1,4-dioxobutane-2-sulfonate (PubChem CID 20670459) has the molecular formula C6H9O7S- and a molecular weight of 225.20 g/mol. Its IUPAC name is 1,4-dimethoxy-1,4-dioxobutane-2-sulfonate.
| Compound Name | 1,4-dimethoxy-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 20670459 |
| Molecular Formula | C6H9O7S- |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 1,4-dimethoxy-1,4-dioxobutane-2-sulfonate |
| SMILES | COC(=O)CC(C(=O)OC)S(=O)(=O)[O-] |
| InChI | InChI=1S/C6H10O7S/c1-12-5(7)3-4(6(8)13-2)14(9,10)11/h4H,3H2,1-2H3,(H,9,10,11)/p-1 |
| InChIKey | KNZGECOKJOJOSP-UHFFFAOYSA-M |
| XLogP | -1.36 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|