C18H33NaO7S — CID 23671437
sodium 1,4-bis(2-methylhexoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 23671437) has the molecular formula C18H33NaO7S and a molecular weight of 416.51 g/mol. Its IUPAC name is sodium 1,4-bis(2-methylhexoxy)-1,4-dioxobutane-2-sulfonate.
| Compound Name | sodium 1,4-bis(2-methylhexoxy)-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 23671437 |
| Molecular Formula | C18H33NaO7S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | sodium 1,4-bis(2-methylhexoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CCCCC(C)COC(=O)CC(C(=O)OCC(C)CCCC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H34O7S.Na/c1-5-7-9-14(3)12-24-17(19)11-16(26(21,22)23)18(20)25-13-15(4)10-8-6-2;/h14-16H,5-13H2,1-4H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | FZTZVXFPRHINHO-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|