About sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate
sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate (PubChem CID 174583962) has the molecular formula C10H19NaO7S
and a molecular weight of 306.31 g/mol. Its IUPAC name is sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate.
Molecular Properties
| Compound Name | sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate |
| PubChem CID | 174583962 |
| Molecular Formula | C10H19NaO7S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate |
| SMILES | COC(=O)C(CC(=O)OCC(C)C)S(=O)(=O)OC.[H-].[Na+] |
| InChI | InChI=1S/C10H18O7S.Na.H/c1-7(2)6-17-9(11)5-8(10(12)15-3)18(13,14)16-4;;/h7-8H,5-6H2,1-4H3;;/q;+1;-1 |
| InChIKey | FJQWNFHFNWFGRV-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate?
The IUPAC name of sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate (CID 174583962) is sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate.
What is the SMILES notation for sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate?
The canonical SMILES for sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate is COC(=O)C(CC(=O)OCC(C)C)S(=O)(=O)OC.[H-].[Na+].
What is the InChIKey of sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate?
The InChIKey is FJQWNFHFNWFGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O7S.Na.H/c1-7(2)6-17-9(11)5-8(10(12)15-3)18(13,14)16-4;;/h7-8H,5-6H2,1-4H3;;/q;+1;-1.
What are the key properties of sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate?
sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate has a molecular weight of 306.31 g/mol, XLogP of -2.79, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1-O-methyl 4-O-(2-methylpropyl) 2-methoxysulfonylbutanedioate is sourced from PubChem (CID 174583962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).