C22H42O7S — CID 170250816
2-ethylhexyl 5-(2-ethylhexoxy)-3-methoxysulfonyl-4-oxopentanoate (PubChem CID 170250816) has the molecular formula C22H42O7S and a molecular weight of 450.64 g/mol. Its IUPAC name is 2-ethylhexyl 5-(2-ethylhexoxy)-3-methoxysulfonyl-4-oxopentanoate.
| Compound Name | 2-ethylhexyl 5-(2-ethylhexoxy)-3-methoxysulfonyl-4-oxopentanoate |
|---|---|
| PubChem CID | 170250816 |
| Molecular Formula | C22H42O7S |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 2-ethylhexyl 5-(2-ethylhexoxy)-3-methoxysulfonyl-4-oxopentanoate |
| SMILES | CCCCC(CC)COCC(=O)C(CC(=O)OCC(CC)CCCC)S(=O)(=O)OC |
| InChI | InChI=1S/C22H42O7S/c1-6-10-12-18(8-3)15-28-17-20(23)21(30(25,26)27-5)14-22(24)29-16-19(9-4)13-11-7-2/h18-19,21H,6-17H2,1-5H3 |
| InChIKey | UOTWJEWVZNNZMG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|