About sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride
sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride (PubChem CID 173324530) has the molecular formula C12H21NaO6S
and a molecular weight of 316.35 g/mol. Its IUPAC name is sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride.
Molecular Properties
| Compound Name | sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride |
| PubChem CID | 173324530 |
| Molecular Formula | C12H21NaO6S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride |
| SMILES | CC(C)COC(=O)CC(C(=O)OCC(C)C)=S(=O)=O.[H-].[Na+] |
| InChI | InChI=1S/C12H20O6S.Na.H/c1-8(2)6-17-11(13)5-10(19(15)16)12(14)18-7-9(3)4;;/h8-9H,5-7H2,1-4H3;;/q;+1;-1 |
| InChIKey | ZUYYBQIPLOTMMM-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride?
The IUPAC name of sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride (CID 173324530) is sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride.
What is the SMILES notation for sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride?
The canonical SMILES for sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride is CC(C)COC(=O)CC(C(=O)OCC(C)C)=S(=O)=O.[H-].[Na+].
What is the InChIKey of sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride?
The InChIKey is ZUYYBQIPLOTMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6S.Na.H/c1-8(2)6-17-11(13)5-10(19(15)16)12(14)18-7-9(3)4;;/h8-9H,5-7H2,1-4H3;;/q;+1;-1.
What are the key properties of sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride?
sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride has a molecular weight of 316.35 g/mol, XLogP of -2.06, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;bis(2-methylpropyl) 2-sulfonylbutanedioate;hydride is sourced from PubChem (CID 173324530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).