C13H20Cl2O5 — CID 159836440
1-chloropentane-2,4-dione;2-methylpropyl 4-chloro-3-oxobutanoate (PubChem CID 159836440) has the molecular formula C13H20Cl2O5 and a molecular weight of 327.20 g/mol. Its IUPAC name is 1-chloropentane-2,4-dione;2-methylpropyl 4-chloro-3-oxobutanoate.
| Compound Name | 1-chloropentane-2,4-dione;2-methylpropyl 4-chloro-3-oxobutanoate |
|---|---|
| PubChem CID | 159836440 |
| Molecular Formula | C13H20Cl2O5 |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-chloropentane-2,4-dione;2-methylpropyl 4-chloro-3-oxobutanoate |
| SMILES | CC(=O)CC(=O)CCl.CC(C)COC(=O)CC(=O)CCl |
| InChI | InChI=1S/C8H13ClO3.C5H7ClO2/c1-6(2)5-12-8(11)3-7(10)4-9;1-4(7)2-5(8)3-6/h6H,3-5H2,1-2H3;2-3H2,1H3 |
| InChIKey | NODDQOGTWIMLNC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|