C53H49NS — CID 170141928
2-dibenzothiophen-1-yl-N-[2-(5,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]-4-phenylaniline (PubChem CID 170141928) has the molecular formula C53H49NS and a molecular weight of 732.05 g/mol. Its IUPAC name is 2-dibenzothiophen-1-yl-N-[2-(5,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]-4-phenylaniline.
| Compound Name | 2-dibenzothiophen-1-yl-N-[2-(5,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 170141928 |
| Molecular Formula | C53H49NS |
| Molecular Weight | 732.05 g/mol |
| Exact Mass | 731.36 |
| IUPAC Name | 2-dibenzothiophen-1-yl-N-[2-(5,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]-4-phenylaniline |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)C(C)(C)c1cccc(-c3ccccc3Nc3ccc(-c4ccccc4)cc3-c3cccc4sc5ccccc5c34)c1-2 |
| InChI | InChI=1S/C53H49NS/c1-51(2,3)35-31-42(52(4,5)6)50-43(32-35)53(7,8)41-24-16-22-37(49(41)50)36-20-12-14-25-44(36)54-45-29-28-34(33-18-10-9-11-19-33)30-40(45)38-23-17-27-47-48(38)39-21-13-15-26-46(39)55-47/h9-32,54H,1-8H3 |
| InChIKey | AZTOAPUMXNUANE-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.05 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |