C14H21F3N4O3S — CID 170144103
1-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]sulfonyl-4-(oxolan-3-ylmethyl)piperazine (PubChem CID 170144103) has the molecular formula C14H21F3N4O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]sulfonyl-4-(oxolan-3-ylmethyl)piperazine.
| Compound Name | 1-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]sulfonyl-4-(oxolan-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 170144103 |
| Molecular Formula | C14H21F3N4O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]sulfonyl-4-(oxolan-3-ylmethyl)piperazine |
| SMILES | Cn1nc(C(F)(F)F)cc1S(=O)(=O)N1CCN(CC2CCOC2)CC1 |
| InChI | InChI=1S/C14H21F3N4O3S/c1-19-13(8-12(18-19)14(15,16)17)25(22,23)21-5-3-20(4-6-21)9-11-2-7-24-10-11/h8,11H,2-7,9-10H2,1H3 |
| InChIKey | LJTDDYGGVDIUNF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |