About 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine
4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine (PubChem CID 170144843) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine |
| PubChem CID | 170144843 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine |
| SMILES | Cc1cnn2cc(N3CCOCC3)ccc12 |
| InChI | InChI=1S/C12H15N3O/c1-10-8-13-15-9-11(2-3-12(10)15)14-4-6-16-7-5-14/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | GKDIYYVWWCXZQI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine?
The IUPAC name of 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine (CID 170144843) is 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine.
What is the SMILES notation for 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine?
The canonical SMILES for 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine is Cc1cnn2cc(N3CCOCC3)ccc12.
What is the InChIKey of 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine?
The InChIKey is GKDIYYVWWCXZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-10-8-13-15-9-11(2-3-12(10)15)14-4-6-16-7-5-14/h2-3,8-9H,4-7H2,1H3.
What are the key properties of 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine?
4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine has a molecular weight of 217.27 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylpyrazolo[1,5-a]pyridin-6-yl)morpholine is sourced from PubChem (CID 170144843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).