C14H14ClN5O2S — CID 170147480
5-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2H-triazole-4-carbonitrile (PubChem CID 170147480) has the molecular formula C14H14ClN5O2S and a molecular weight of 351.82 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 170147480 |
| Molecular Formula | C14H14ClN5O2S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 5-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H14ClN5O2S/c15-11-1-3-12(4-2-11)23(21,22)20-7-5-10(6-8-20)14-13(9-16)17-19-18-14/h1-4,10H,5-8H2,(H,17,18,19) |
| InChIKey | ZDAGCZIKKCNIMJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |