C16H10F3N5S — CID 170148108
5-[5-[8-(trifluoromethyl)quinolin-3-yl]thiophen-2-yl]-2H-triazol-4-amine (PubChem CID 170148108) has the molecular formula C16H10F3N5S and a molecular weight of 361.35 g/mol. Its IUPAC name is 5-[5-[8-(trifluoromethyl)quinolin-3-yl]thiophen-2-yl]-2H-triazol-4-amine.
| Compound Name | 5-[5-[8-(trifluoromethyl)quinolin-3-yl]thiophen-2-yl]-2H-triazol-4-amine |
|---|---|
| PubChem CID | 170148108 |
| Molecular Formula | C16H10F3N5S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 5-[5-[8-(trifluoromethyl)quinolin-3-yl]thiophen-2-yl]-2H-triazol-4-amine |
| SMILES | Nc1n[nH]nc1-c1ccc(-c2cnc3c(C(F)(F)F)cccc3c2)s1 |
| InChI | InChI=1S/C16H10F3N5S/c17-16(18,19)10-3-1-2-8-6-9(7-21-13(8)10)11-4-5-12(25-11)14-15(20)23-24-22-14/h1-7H,(H3,20,22,23,24) |
| InChIKey | WWSLJBIBBGHFEK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |