C14H18N4S — CID 170148109
5-[5-[(E)-2-cyclohexylethenyl]thiophen-2-yl]-2H-triazol-4-amine (PubChem CID 170148109) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-[5-[(E)-2-cyclohexylethenyl]thiophen-2-yl]-2H-triazol-4-amine.
| Compound Name | 5-[5-[(E)-2-cyclohexylethenyl]thiophen-2-yl]-2H-triazol-4-amine |
|---|---|
| PubChem CID | 170148109 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 5-[5-[(E)-2-cyclohexylethenyl]thiophen-2-yl]-2H-triazol-4-amine |
| SMILES | Nc1n[nH]nc1-c1ccc(/C=C/C2CCCCC2)s1 |
| InChI | InChI=1S/C14H18N4S/c15-14-13(16-18-17-14)12-9-8-11(19-12)7-6-10-4-2-1-3-5-10/h6-10H,1-5H2,(H3,15,16,17,18)/b7-6+ |
| InChIKey | KDVVKGQHPSKMPK-VOTSOKGWSA-N |
| XLogP | 3.71 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |