C24H27F3N4O7S2 — CID 170151072
[2-[(3S,5S)-1-[[5-(aminomethyl)-3-pyridinyl]sulfonyl]-5-(1,1-dioxo-1,4-thiazinane-4-carbonyl)piperidin-3-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 170151072) has the molecular formula C24H27F3N4O7S2 and a molecular weight of 604.63 g/mol. Its IUPAC name is [2-[(3S,5S)-1-[[5-(aminomethyl)-3-pyridinyl]sulfonyl]-5-(1,1-dioxo-1,4-thiazinane-4-carbonyl)piperidin-3-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[(3S,5S)-1-[[5-(aminomethyl)-3-pyridinyl]sulfonyl]-5-(1,1-dioxo-1,4-thiazinane-4-carbonyl)piperidin-3-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170151072 |
| Molecular Formula | C24H27F3N4O7S2 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | [2-[(3S,5S)-1-[[5-(aminomethyl)-3-pyridinyl]sulfonyl]-5-(1,1-dioxo-1,4-thiazinane-4-carbonyl)piperidin-3-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | NCc1cncc(S(=O)(=O)N2C[C@@H](C(=O)N3CCS(=O)(=O)CC3)C[C@@H](c3ccccc3OC(=O)C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C24H27F3N4O7S2/c25-24(26,27)23(33)38-21-4-2-1-3-20(21)17-10-18(22(32)30-5-7-39(34,35)8-6-30)15-31(14-17)40(36,37)19-9-16(11-28)12-29-13-19/h1-4,9,12-13,17-18H,5-8,10-11,14-15,28H2/t17-,18+/m1/s1 |
| InChIKey | ZXWZLXOABPMSAT-MSOLQXFVSA-N |
| XLogP | 1.06 |
| TPSA | 157.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|