C15H12Cl2N2S — CID 17015142
1-(1H-benzimidazol-2-yl)-2-(2,5-dichlorophenyl)ethanethiol (PubChem CID 17015142) has the molecular formula C15H12Cl2N2S and a molecular weight of 323.25 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-2-(2,5-dichlorophenyl)ethanethiol.
| Compound Name | 1-(1H-benzimidazol-2-yl)-2-(2,5-dichlorophenyl)ethanethiol |
|---|---|
| PubChem CID | 17015142 |
| Molecular Formula | C15H12Cl2N2S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-2-(2,5-dichlorophenyl)ethanethiol |
| SMILES | SC(Cc1cc(Cl)ccc1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H12Cl2N2S/c16-10-5-6-11(17)9(7-10)8-14(20)15-18-12-3-1-2-4-13(12)19-15/h1-7,14,20H,8H2,(H,18,19) |
| InChIKey | LYTSIBHTDDLDGT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|