C25H22FN7O2 — CID 170154896
1-[3-[4-amino-5-[2-[2-(azetidin-1-yl)-6-fluoro-1,3-benzoxazol-5-yl]ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170154896) has the molecular formula C25H22FN7O2 and a molecular weight of 471.50 g/mol. Its IUPAC name is 1-[3-[4-amino-5-[2-[2-(azetidin-1-yl)-6-fluoro-1,3-benzoxazol-5-yl]ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-5-[2-[2-(azetidin-1-yl)-6-fluoro-1,3-benzoxazol-5-yl]ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170154896 |
| Molecular Formula | C25H22FN7O2 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-[3-[4-amino-5-[2-[2-(azetidin-1-yl)-6-fluoro-1,3-benzoxazol-5-yl]ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2cc(C#Cc3cc4nc(N5CCC5)oc4cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C25H22FN7O2/c1-2-21(34)32-9-6-17(13-32)33-12-16(22-23(27)28-14-29-24(22)33)5-4-15-10-19-20(11-18(15)26)35-25(30-19)31-7-3-8-31/h2,10-12,14,17H,1,3,6-9,13H2,(H2,27,28,29) |
| InChIKey | CZJOZFVKLCAQSO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|