C24H20FN7OS — CID 170154628
1-[3-[4-amino-3-[2-(2-cyclopropyl-6-fluoro-1,3-benzothiazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170154628) has the molecular formula C24H20FN7OS and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[2-(2-cyclopropyl-6-fluoro-1,3-benzothiazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[2-(2-cyclopropyl-6-fluoro-1,3-benzothiazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170154628 |
| Molecular Formula | C24H20FN7OS |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 1-[3-[4-amino-3-[2-(2-cyclopropyl-6-fluoro-1,3-benzothiazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2nc(C#Cc3cc4nc(C5CC5)sc4cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C24H20FN7OS/c1-2-20(33)31-8-7-15(11-31)32-23-21(22(26)27-12-28-23)17(30-32)6-5-14-9-18-19(10-16(14)25)34-24(29-18)13-3-4-13/h2,9-10,12-13,15H,1,3-4,7-8,11H2,(H2,26,27,28) |
| InChIKey | XDCGMDVUVYWCGU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|