C18H17N5O2 — CID 17015846
N-(3-acetylphenyl)-5-amino-1-(2-methylphenyl)triazole-4-carboxamide (PubChem CID 17015846) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-5-amino-1-(2-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-5-amino-1-(2-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 17015846 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(3-acetylphenyl)-5-amino-1-(2-methylphenyl)triazole-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2nnn(-c3ccccc3C)c2N)c1 |
| InChI | InChI=1S/C18H17N5O2/c1-11-6-3-4-9-15(11)23-17(19)16(21-22-23)18(25)20-14-8-5-7-13(10-14)12(2)24/h3-10H,19H2,1-2H3,(H,20,25) |
| InChIKey | IYLBNSJJRFDCMT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |