C24H28FN3O — CID 170159206
4-[1-[3-(4-fluoro-7-methylindol-1-yl)phenyl]piperidin-4-yl]morpholine (PubChem CID 170159206) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is 4-[1-[3-(4-fluoro-7-methylindol-1-yl)phenyl]piperidin-4-yl]morpholine.
| Compound Name | 4-[1-[3-(4-fluoro-7-methylindol-1-yl)phenyl]piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 170159206 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 4-[1-[3-(4-fluoro-7-methylindol-1-yl)phenyl]piperidin-4-yl]morpholine |
| SMILES | Cc1ccc(F)c2ccn(-c3cccc(N4CCC(N5CCOCC5)CC4)c3)c12 |
| InChI | InChI=1S/C24H28FN3O/c1-18-5-6-23(25)22-9-12-28(24(18)22)21-4-2-3-20(17-21)26-10-7-19(8-11-26)27-13-15-29-16-14-27/h2-6,9,12,17,19H,7-8,10-11,13-16H2,1H3 |
| InChIKey | INOKOTNFRSORJK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |