C24H24N4O5 — CID 170161420
2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]ethyl formate (PubChem CID 170161420) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]ethyl formate.
| Compound Name | 2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]ethyl formate |
|---|---|
| PubChem CID | 170161420 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]ethyl formate |
| SMILES | Cc1cc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nc2c1CCN2CCOC=O |
| InChI | InChI=1S/C24H24N4O5/c1-14-10-19(25-22-17(14)6-7-27(22)8-9-33-13-29)15-2-3-18-16(11-15)12-28(24(18)32)20-4-5-21(30)26-23(20)31/h2-3,10-11,13,20H,4-9,12H2,1H3,(H,26,30,31) |
| InChIKey | AREZTBHWWYNHAP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|