C18H21NO2 — CID 170161835
tert-butyl 5-(2,4-dimethylphenyl)pyridine-2-carboxylate (PubChem CID 170161835) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl 5-(2,4-dimethylphenyl)pyridine-2-carboxylate.
| Compound Name | tert-butyl 5-(2,4-dimethylphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 170161835 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | tert-butyl 5-(2,4-dimethylphenyl)pyridine-2-carboxylate |
| SMILES | Cc1ccc(-c2ccc(C(=O)OC(C)(C)C)nc2)c(C)c1 |
| InChI | InChI=1S/C18H21NO2/c1-12-6-8-15(13(2)10-12)14-7-9-16(19-11-14)17(20)21-18(3,4)5/h6-11H,1-5H3 |
| InChIKey | ZEDJHWIJOCDVDF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |