C15H15NO — CID 82080805
1-[5-(2,5-dimethylphenyl)-2-pyridinyl]ethanone (PubChem CID 82080805) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-[5-(2,5-dimethylphenyl)-2-pyridinyl]ethanone.
| Compound Name | 1-[5-(2,5-dimethylphenyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 82080805 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-[5-(2,5-dimethylphenyl)-2-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cc(C)ccc2C)cn1 |
| InChI | InChI=1S/C15H15NO/c1-10-4-5-11(2)14(8-10)13-6-7-15(12(3)17)16-9-13/h4-9H,1-3H3 |
| InChIKey | CRCRSUBNYYKAIX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |