C12H16O8 — CID 170162415
3-[2-(3-prop-2-enoyloxypropanoyloxy)propanoyloxy]propanoic acid (PubChem CID 170162415) has the molecular formula C12H16O8 and a molecular weight of 288.25 g/mol. Its IUPAC name is 3-[2-(3-prop-2-enoyloxypropanoyloxy)propanoyloxy]propanoic acid.
| Compound Name | 3-[2-(3-prop-2-enoyloxypropanoyloxy)propanoyloxy]propanoic acid |
|---|---|
| PubChem CID | 170162415 |
| Molecular Formula | C12H16O8 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[2-(3-prop-2-enoyloxypropanoyloxy)propanoyloxy]propanoic acid |
| SMILES | C=CC(=O)OCCC(=O)OC(C)C(=O)OCCC(=O)O |
| InChI | InChI=1S/C12H16O8/c1-3-10(15)18-7-5-11(16)20-8(2)12(17)19-6-4-9(13)14/h3,8H,1,4-7H2,2H3,(H,13,14) |
| InChIKey | MBSUICZGGPORKJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|