C15H20O10 — CID 88819588
2-[3-propanoyloxy-3-(3-prop-2-enoyloxypropanoyloxy)propanoyl]oxypropanoic acid (PubChem CID 88819588) has the molecular formula C15H20O10 and a molecular weight of 360.32 g/mol. Its IUPAC name is 2-[3-propanoyloxy-3-(3-prop-2-enoyloxypropanoyloxy)propanoyl]oxypropanoic acid.
| Compound Name | 2-[3-propanoyloxy-3-(3-prop-2-enoyloxypropanoyloxy)propanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 88819588 |
| Molecular Formula | C15H20O10 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[3-propanoyloxy-3-(3-prop-2-enoyloxypropanoyloxy)propanoyl]oxypropanoic acid |
| SMILES | C=CC(=O)OCCC(=O)OC(CC(=O)OC(C)C(=O)O)OC(=O)CC |
| InChI | InChI=1S/C15H20O10/c1-4-10(16)22-7-6-12(18)25-14(24-11(17)5-2)8-13(19)23-9(3)15(20)21/h4,9,14H,1,5-8H2,2-3H3,(H,20,21) |
| InChIKey | NACBUKWPHZRZPP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|