C9H20N4S2 — CID 170162809
1,3-diethyl-1-(propylcarbamothioylamino)thiourea (PubChem CID 170162809) has the molecular formula C9H20N4S2 and a molecular weight of 248.42 g/mol. Its IUPAC name is 1,3-diethyl-1-(propylcarbamothioylamino)thiourea.
| Compound Name | 1,3-diethyl-1-(propylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 170162809 |
| Molecular Formula | C9H20N4S2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1,3-diethyl-1-(propylcarbamothioylamino)thiourea |
| SMILES | CCCNC(=S)NN(CC)C(=S)NCC |
| InChI | InChI=1S/C9H20N4S2/c1-4-7-11-8(14)12-13(6-3)9(15)10-5-2/h4-7H2,1-3H3,(H,10,15)(H2,11,12,14) |
| InChIKey | HCFJOCXCLDDKGW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|