C14H30N4S2 — CID 87871224
1,3-dibutyl-1-[ethyl(ethylcarbamothioyl)amino]thiourea (PubChem CID 87871224) has the molecular formula C14H30N4S2 and a molecular weight of 318.56 g/mol. Its IUPAC name is 1,3-dibutyl-1-[ethyl(ethylcarbamothioyl)amino]thiourea.
| Compound Name | 1,3-dibutyl-1-[ethyl(ethylcarbamothioyl)amino]thiourea |
|---|---|
| PubChem CID | 87871224 |
| Molecular Formula | C14H30N4S2 |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1,3-dibutyl-1-[ethyl(ethylcarbamothioyl)amino]thiourea |
| SMILES | CCCCNC(=S)N(CCCC)N(CC)C(=S)NCC |
| InChI | InChI=1S/C14H30N4S2/c1-5-9-11-16-14(20)18(12-10-6-2)17(8-4)13(19)15-7-3/h5-12H2,1-4H3,(H,15,19)(H,16,20) |
| InChIKey | RACMJKYNUNFKOW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|