C10H22N4S2 — CID 5162306
1,3-dimethyl-1-[4-[methyl(methylcarbamothioyl)amino]butyl]thiourea (PubChem CID 5162306) has the molecular formula C10H22N4S2 and a molecular weight of 262.45 g/mol. Its IUPAC name is 1,3-dimethyl-1-[4-[methyl(methylcarbamothioyl)amino]butyl]thiourea.
| Compound Name | 1,3-dimethyl-1-[4-[methyl(methylcarbamothioyl)amino]butyl]thiourea |
|---|---|
| PubChem CID | 5162306 |
| Molecular Formula | C10H22N4S2 |
| Molecular Weight | 262.45 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1,3-dimethyl-1-[4-[methyl(methylcarbamothioyl)amino]butyl]thiourea |
| SMILES | CNC(=S)N(C)CCCCN(C)C(=S)NC |
| InChI | InChI=1S/C10H22N4S2/c1-11-9(15)13(3)7-5-6-8-14(4)10(16)12-2/h5-8H2,1-4H3,(H,11,15)(H,12,16) |
| InChIKey | NTDBEWVEBFSVFQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|