C22H29NO2S — CID 170163143
2-methyl-3-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropanal;toluene (PubChem CID 170163143) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is 2-methyl-3-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropanal;toluene.
| Compound Name | 2-methyl-3-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropanal;toluene |
|---|---|
| PubChem CID | 170163143 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-methyl-3-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropanal;toluene |
| SMILES | CSc1ccc(CC(C)(C=O)N2CCOCC2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO2S.C7H8/c1-15(12-17,16-7-9-18-10-8-16)11-13-3-5-14(19-2)6-4-13;1-7-5-3-2-4-6-7/h3-6,12H,7-11H2,1-2H3;2-6H,1H3 |
| InChIKey | QPRIPZLBGUTJDE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|