C26H33N3O2 — CID 170163358
5-[1-[(1S)-2-hydroxy-1-phenylethyl]piperidin-4-yl]-2-piperidin-3-yl-3H-isoindol-1-one (PubChem CID 170163358) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 5-[1-[(1S)-2-hydroxy-1-phenylethyl]piperidin-4-yl]-2-piperidin-3-yl-3H-isoindol-1-one.
| Compound Name | 5-[1-[(1S)-2-hydroxy-1-phenylethyl]piperidin-4-yl]-2-piperidin-3-yl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 170163358 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 5-[1-[(1S)-2-hydroxy-1-phenylethyl]piperidin-4-yl]-2-piperidin-3-yl-3H-isoindol-1-one |
| SMILES | O=C1c2ccc(C3CCN([C@H](CO)c4ccccc4)CC3)cc2CN1C1CCCNC1 |
| InChI | InChI=1S/C26H33N3O2/c30-18-25(20-5-2-1-3-6-20)28-13-10-19(11-14-28)21-8-9-24-22(15-21)17-29(26(24)31)23-7-4-12-27-16-23/h1-3,5-6,8-9,15,19,23,25,27,30H,4,7,10-14,16-18H2/t23?,25-/m1/s1 |
| InChIKey | UTHGIJYHSRUHMZ-XSWBTSGESA-N |
| XLogP | 3.31 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |