C22H35N3O4 — CID 175824867
5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-2-piperidin-3-yl-3H-isoindol-1-one (PubChem CID 175824867) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-2-piperidin-3-yl-3H-isoindol-1-one.
| Compound Name | 5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-2-piperidin-3-yl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 175824867 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 5-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-2-piperidin-3-yl-3H-isoindol-1-one |
| SMILES | NCCOCCOCCOCCCc1ccc2c(c1)CN(C1CCCNC1)C2=O |
| InChI | InChI=1S/C22H35N3O4/c23-7-10-28-12-14-29-13-11-27-9-2-3-18-5-6-21-19(15-18)17-25(22(21)26)20-4-1-8-24-16-20/h5-6,15,20,24H,1-4,7-14,16-17,23H2 |
| InChIKey | JVQOPVWZUYFHPC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|