C19H29N3O5S — CID 175716605
4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfonyl]-2-piperidin-3-yl-3H-isoindol-1-one (PubChem CID 175716605) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfonyl]-2-piperidin-3-yl-3H-isoindol-1-one.
| Compound Name | 4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfonyl]-2-piperidin-3-yl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 175716605 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfonyl]-2-piperidin-3-yl-3H-isoindol-1-one |
| SMILES | NCCOCCOCCS(=O)(=O)c1cccc2c1CN(C1CCCNC1)C2=O |
| InChI | InChI=1S/C19H29N3O5S/c20-6-8-26-9-10-27-11-12-28(24,25)18-5-1-4-16-17(18)14-22(19(16)23)15-3-2-7-21-13-15/h1,4-5,15,21H,2-3,6-14,20H2 |
| InChIKey | OODTYWPXCLIEFD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|