C28H26F3N7O3 — CID 170164793
(1R,2S,5S)-N-[cyano(1,6-naphthyridin-8-yl)methyl]-6,6-dimethyl-3-[3-pyridin-3-yl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170164793) has the molecular formula C28H26F3N7O3 and a molecular weight of 565.56 g/mol. Its IUPAC name is (1R,2S,5S)-N-[cyano(1,6-naphthyridin-8-yl)methyl]-6,6-dimethyl-3-[3-pyridin-3-yl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[cyano(1,6-naphthyridin-8-yl)methyl]-6,6-dimethyl-3-[3-pyridin-3-yl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170164793 |
| Molecular Formula | C28H26F3N7O3 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (1R,2S,5S)-N-[cyano(1,6-naphthyridin-8-yl)methyl]-6,6-dimethyl-3-[3-pyridin-3-yl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC1(C)[C@@H]2[C@@H](C(=O)NC(C#N)c3cncc4cccnc34)N(C(=O)C(Cc3cccnc3)NC(=O)C(F)(F)F)C[C@@H]21 |
| InChI | InChI=1S/C28H26F3N7O3/c1-27(2)18-14-38(25(40)19(37-26(41)28(29,30)31)9-15-5-3-7-33-11-15)23(21(18)27)24(39)36-20(10-32)17-13-34-12-16-6-4-8-35-22(16)17/h3-8,11-13,18-21,23H,9,14H2,1-2H3,(H,36,39)(H,37,41)/t18-,19?,20?,21-,23-/m0/s1 |
| InChIKey | NQAPFDDAMJHSCP-UDBXIDOISA-N |
| XLogP | 2.48 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |